4-bromo-2-methyl-6-nitrophenol
$250.00
CAS No.: 20294-50-2
Catalog No.: 189370
Purity: 95%
MF: C7H6BrNO3
MW: 232.033
Storage: 2-8 degree Celsius
SMILES: BrC1=CC(=C(C(=C1)[N+](=O)[O-])O)C
Catalog No.: 189370
Purity: 95%
MF: C7H6BrNO3
MW: 232.033
Storage: 2-8 degree Celsius
SMILES: BrC1=CC(=C(C(=C1)[N+](=O)[O-])O)C
4-bromo-2-methyl-6-nitrophenol; CAS No.: 20294-50-2; 4-bromo-2-methyl-6-nitrophenol is part of Chem Shuttle's offering of bromomethylnitrophenols that serve as key intermediates in organic synthesis. As a custom chemical synthesis company, Chem Shuttle specializes in producing phenol derivatives with bromo, methyl, and nitro substituents that are crucial for the development of various pharmaceuticals and agrochemicals. This compound, with its bromo, methyl, and nitro groups, is particularly valuable as a building block for the synthesis of bioactive molecules with specific receptor affinities. Chem Shuttle's online chemical mall provides researchers with convenient access to such specialized chemicals, supporting their work in medicinal chemistry and organic synthesis. The company's expertise in process chemistry ensures that 4-bromo-2-methyl-6-nitrophenol is produced efficiently and to high purity standards, making it a reliable component in various synthetic pathways.
Reviews
Write Your Own Review