![2-chloro-4-morpholinothieno[3,2-d]pyrimidine-6-carbaldehyde](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/2/129558_3.jpg)
4-bromo-1-methyl-2-nitro-1H-imidazole
$300.00
CAS No.: 121816-79-3
Catalog No.: 129543
Purity: 95%
MF: C4H4BrN3O2
MW: 205.999
Storage: 2-8 degree Celsius
SMILES: CN1C=C(Br)N=C1[N+]([O-])=O
Catalog No.: 129543
Purity: 95%
MF: C4H4BrN3O2
MW: 205.999
Storage: 2-8 degree Celsius
SMILES: CN1C=C(Br)N=C1[N+]([O-])=O
4-bromo-1-methyl-2-nitro-1H-imidazole; CAS No.: 121816-79-3: This compound is used in the synthesis of complex organic molecules. Its unique chemical structure and reactivity profile make it valuable in the production of fine chemicals and intermediates.
Reviews
Write Your Own Review