4-((benzyloxy)carbonyl)piperazine-2-carboxylic acid
$250.00
CAS No.: 64172-98-1
Catalog No.: 138404
Purity: 95%
MF: C13H16N2O4
MW: 264.281
Storage: 2-8 degree Celsius
SMILES: OC(=O)C1CN(CCN1)C(=O)OCC1=CC=CC=C1
Catalog No.: 138404
Purity: 95%
MF: C13H16N2O4
MW: 264.281
Storage: 2-8 degree Celsius
SMILES: OC(=O)C1CN(CCN1)C(=O)OCC1=CC=CC=C1
4-((benzyloxy)carbonyl)piperazine-2-carboxylic acid; CAS No.:64172-98-1; 4-((benzyloxy)carbonyl)piperazine-2-carboxylic acid. ChemShuttle, a custom chemical synthesis company, provides various chemical blocks. The compound 4 - ((benzyloxy)carbonyl)piperazine - 2 - carboxylic acid (CAS No.:64172-98-1) is one of the chemical blocks. It can be used as a building block in the synthesis of more complex organic molecules. Chemical blocks are fundamental units that can be combined to create new compounds with desired properties. ChemShuttle's chemical blocks collection is extensive and diverse to support various research and industrial applications.
Reviews
Write Your Own Review