4-acetyl-2-chlorobenzoic acid
$200.00
CAS No.: 115382-35-9
Catalog No.: 190384
Purity: 95%
MF: C9H7ClO3
MW: 198.605
Storage: 2-8 degree Celsius
SMILES: C(C)(=O)C1=CC(=C(C(=O)O)C=C1)Cl
Catalog No.: 190384
Purity: 95%
MF: C9H7ClO3
MW: 198.605
Storage: 2-8 degree Celsius
SMILES: C(C)(=O)C1=CC(=C(C(=O)O)C=C1)Cl
4-acetyl-2-chlorobenzoic acid; CAS No.: 115382-35-9; 4-acetyl-2-chlorobenzoic acid. As a chemical synthesis company, ChemShuttle specializes in offering diverse Screening compounds, including 4-acetyl-2-chlorobenzoic acid (CAS No.: 115382-35-9). This compound is a key intermediate in the synthesis of various pharmaceuticals and specialty chemicals. ChemShuttle s custom synthesis services allow for the production of such specialized compounds, meeting the specific needs of clients in the chemical and pharmaceutical industries. The company s expertise in chemical synthesis ensures high-quality and efficient production of these essential building blocks for various applications.
Reviews
Write Your Own Review