4,5-dimethyl-2-nitroaniline
$250.00
CAS No.: 6972-71-0
Catalog No.: 190712
Purity: 95%
MF: C8H10N2O2
MW: 166.18
Storage: 2-8 degree Celsius
SMILES: CC1=CC(=C(N)C=C1C)[N+](=O)[O-]
Catalog No.: 190712
Purity: 95%
MF: C8H10N2O2
MW: 166.18
Storage: 2-8 degree Celsius
SMILES: CC1=CC(=C(N)C=C1C)[N+](=O)[O-]
4,5-dimethyl-2-nitroaniline; CAS No.: 6972-71-0; 4,5-dimethyl-2-nitroaniline is part of ChemShuttle's diverse portfolio of screening compounds, reflecting the company's role as a leading chemicals distributor. This particular compound, with its distinctive nitro and methyl group substitutions, is indicative of the various organic chemicals that ChemShuttle specializes in. As a custom chemical synthesis company, ChemShuttle offers process chemistry services that enable the efficient production of complex molecules such as 4,5-dimethyl-2-nitroaniline. The company's online platform serves as a chemical online mall, providing researchers and industries with easy access to a vast array of chemical building blocks. ChemShuttle's expertise in small molecules synthesis ensures that compounds like 4,5-dimethyl-2-nitroaniline (CAS No.: 6972-71-0) meet the highest standards of purity and quality, making them indispensable for applications in drug development and chemical research.
Reviews
Write Your Own Review