4,5-dimethoxy-2-nitroaniline
$360.00
CAS No.: 7595-31-5
Catalog No.: 189315
Purity: 95%
MF: C8H10N2O4
MW: 198.178
Storage: 2-8 degree Celsius
SMILES: COC1=CC(=C(N)C=C1OC)[N+](=O)[O-]
Catalog No.: 189315
Purity: 95%
MF: C8H10N2O4
MW: 198.178
Storage: 2-8 degree Celsius
SMILES: COC1=CC(=C(N)C=C1OC)[N+](=O)[O-]
4,5-dimethoxy-2-nitroaniline; CAS No.: 7595-31-5; 4,5-dimethoxy-2-nitroaniline exemplifies the methoxynitroaniline category within Chem Shuttle's product offerings. As a chemical online store, Chem Shuttle provides access to aniline derivatives with methoxy and nitro substituents that are crucial for the development of various pharmaceuticals and agrochemicals with specific biological activities. This compound, with its methoxy and nitro groups, serves as a valuable building block for the synthesis of bioactive molecules targeting specific enzymes and receptors. Chem Shuttle's custom synthesis services allow for the production of such specialized methoxynitroanilines to exact specifications, supporting the discovery of novel therapeutic agents. The company's expertise in cycle compounds ensures that researchers can obtain high-purity 4,5-dimethoxy-2-nitroaniline, facilitating advancements in medicinal chemistry and organic synthesis.
Reviews
Write Your Own Review