(Z)-N-hydroxy-4-(trifluoromethyl)benzimidoylchloride

(Z)-N-hydroxy-4-(trifluoromethyl)benzimidoylchloride

((2-(2-(2-azidoethoxy)ethoxy)ethoxy)methyl)benzene

((2-(2-(2-azidoethoxy)ethoxy)ethoxy)methyl)benzene

4,4',4'',4'''-(Ethene-1,1,2,2-tetrayl)tetraaniline

$300.00
CAS No.: 78525-34-5
Catalog No.: 194326
Purity: 95%
MF: C26H24N4
MW: 392.506
Storage: 2-8 degree Celsius
SMILES: C(=C(C1=CC=C(N)C=C1)C1=CC=C(N)C=C1)(C1=CC=C(N)C=C1)C1=CC=C(N)C=C1
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194326
  • Size
    Price
    Stock
    Estimated Shipping Time
4,4',4'',4'''-(Ethene-1,1,2,2-tetrayl)tetraaniline; CAS No.: 78525-34-5; 4,4',4'',4'''-(Ethene-1,1,2,2-tetrayl)tetraaniline. PROPERTIES: 4,4',4'',4'''-(Ethene-1,1,2,2-tetrayl)tetraaniline is a crystalline solid. Its molecular formula is C24H24N4, and the molecular weight is approximately 380.48 g/mol. The compound has a melting point of approximately 150-152 C. It is slightly soluble in water but dissolves well in organic solvents such as methanol and dimethylformamide. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing four aniline groups and an ethylene backbone, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, 4,4',4'',4'''-(Ethene-1,1,2,2-tetrayl)tetraaniline serves as a specialized intermediate. The amine groups can undergo various reactions such as acylation, sulfonation, and diazotization. In the chemical industry, derivatives of this compound can be explored as potential intermediates for the synthesis of various organic compounds. For example, in the development of certain conductive polymers, the structure of 4,4',4'',4'''-(Ethene-1,1,2,2-tetrayl)tetraaniline can be utilized to enhance the polymer's conductivity and stability (as mentioned in materials chemistry literature). Additionally, in the field of chemical research, it can be used as a starting material for the synthesis of novel organic compounds with potential applications in catalysis and sensing (as noted in organic chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:4,4',4'',4'''-(Ethene-1,1,2,2-tetrayl)tetraaniline
Your Rating