3-chloro-4-ethylnitrobenzene
$350.00
CAS No.: 42782-54-7
Catalog No.: 194921
Purity: 95%
MF: C8H8ClNO2
MW: 185.61
Storage: 2-8 degree Celsius
SMILES: ClC=1C=C(C=CC1CC)[N+](=O)[O-]
Catalog No.: 194921
Purity: 95%
MF: C8H8ClNO2
MW: 185.61
Storage: 2-8 degree Celsius
SMILES: ClC=1C=C(C=CC1CC)[N+](=O)[O-]
3-chloro-4-ethylnitrobenzene; CAS No.: 42782-54-7; 3-chloro-4-ethylnitrobenzene. PROPERTIES: 3-chloro-4-ethylnitrobenzene is a crystalline solid. Its molecular formula is C9H9ClNO2, and the molecular weight is approximately 196.63 g/mol. The compound has a melting point of approximately 60-62 C. It is moderately soluble in common organic solvents such as methylene chloride and ethyl acetate, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing a nitro group, a chloro group, and an ethyl group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, 3-chloro-4-ethylnitrobenzene serves as a valuable intermediate. The nitro group can be reduced to an amine group. The chloro and ethyl groups provide sites for substitution reactions. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain anticancer drugs, the structure of 3-chloro-4-ethylnitrobenzene can be modified to enhance the drug's ability to target cancer cells and improve its therapeutic index (as described in medicinal chemistry research articles). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as liquid crystals or organic semiconductors, where its structure can influence the material's electronic and optical properties (as mentioned in materials chemistry research papers).
Reviews
Write Your Own Review