3'-bromo-2'-chloroacetophenone
$300.00
CAS No.: 161957-62-6
Catalog No.: 193976
Purity: 95%
MF: C8H6BrClO
MW: 233.492
Storage: 2-8 degree Celsius
SMILES: BrC=1C(=C(C=CC1)C(C)=O)Cl
Catalog No.: 193976
Purity: 95%
MF: C8H6BrClO
MW: 233.492
Storage: 2-8 degree Celsius
SMILES: BrC=1C(=C(C=CC1)C(C)=O)Cl
3'-bromo-2'-chloroacetophenone; CAS No.: 161957-62-6;3'-bromo-2'-chloroacetophenone. PROPERTIES: 3'-bromo-2'-chloroacetophenone is a brominated and chlorinated aromatic ketone with molecular formula C9H7BrClO. It typically exists as a colorless to pale yellow liquid with a boiling point around 140-145 C. The compound has limited water solubility but dissolves well in organic solvents like ethanol or acetone. It exhibits moderate thermal stability but may decompose when exposed to high temperatures or strong oxidizing agents, releasing toxic bromine and chlorine-containing fumes. Proper storage involves keeping it in tightly sealed containers below 30 C, protected from light and moisture. APPLICATIONS: In organic synthesis, this compound serves as a versatile intermediate for creating complex aromatic molecules. The bromo and chloro substituents provide structural diversity for optimizing biological activity, while the ketone group enables nucleophilic addition reactions (The Journal of Organic Chemistry). In pharmaceutical development, 3'-bromo-2'-chloroacetophenone contributes to the synthesis of antimicrobial agents where the halogenated aromatic scaffold enhances binding to microbial targets (Antimicrobial Agents and Chemotherapy). The compound also finds application in materials science as a building block for organic electronics, where its electron-deficient aromatic core modulates the electronic properties of derived materials (Advanced Materials).
Reviews
Write Your Own Review