3-acetoxybenzoic acid
$300.00
CAS No.: 6304-89-8
Catalog No.: 189325
Purity: 95%
MF: C9H8O4
MW: 180.159
Storage: 2-8 degree Celsius
SMILES: C(C)(=O)OC=1C=C(C(=O)O)C=CC1
Catalog No.: 189325
Purity: 95%
MF: C9H8O4
MW: 180.159
Storage: 2-8 degree Celsius
SMILES: C(C)(=O)OC=1C=C(C(=O)O)C=CC1
3-acetoxybenzoic acid; CAS No.: 6304-89-8; 3-acetoxybenzoic acid exemplifies the acetoxybenzoic acids category within Chem Shuttle's product offerings. As a chemical online store, Chem Shuttle provides access to benzoic acid derivatives with acetoxy substituents that are crucial for the development of various pharmaceuticals and agrochemicals with specific biological activities. This compound, with its acetoxy group, serves as a valuable building block for the synthesis of bioactive molecules targeting specific enzymes and receptors. Chem Shuttle's custom synthesis services allow for the production of such specialized acetoxybenzoic acids to exact specifications, supporting the discovery of novel therapeutic agents. The company's expertise in cycle compounds ensures that researchers can obtain high-purity 3-acetoxybenzoic acid, facilitating advancements in medicinal chemistry and organic synthesis.
Reviews
Write Your Own Review