3-acetamido-4-methyl-2-nitrobenzoic acid
$200.00
CAS No.: 7356-52-7
Catalog No.: 200017
Purity: 95%
MF: C10H10N2O5
MW: 238.199
Storage: 2-8 degree Celsius
SMILES: C(C)(=O)NC=1C(=C(C(=O)O)C=CC1C)[N+](=O)[O-]
Catalog No.: 200017
Purity: 95%
MF: C10H10N2O5
MW: 238.199
Storage: 2-8 degree Celsius
SMILES: C(C)(=O)NC=1C(=C(C(=O)O)C=CC1C)[N+](=O)[O-]
3-acetamido-4-methyl-2-nitrobenzoic acid; CAS No.: 7356-52-7. ChemShuttle operates as a custom synthesis companies, offering high-quality building blocks such as 3-acetamido-4-methyl-2-nitrobenzoic acid. These intermediates are crucial for organic synthesis and drug development. The company s custom synthesis expertise ensures the production of complex molecules with high precision, supporting diverse scientific applications.
Reviews
Write Your Own Review