3,6-dibromo-4-methylquinolin-2(1H)-one
$250.00
CAS No.: 23976-62-7
Catalog No.: 192523
Purity: 95%
MF: C10H7Br2NO
MW: 316.98
Storage: 2-8 degree Celsius
SMILES: BrC=1C(NC2=CC=C(C=C2C1C)Br)=O
Catalog No.: 192523
Purity: 95%
MF: C10H7Br2NO
MW: 316.98
Storage: 2-8 degree Celsius
SMILES: BrC=1C(NC2=CC=C(C=C2C1C)Br)=O
3,6-dibromo-4-methylquinolin-2(1H)-one; CAS No.: 23976-62-7; 3,6-dibromo-4-methylquinolin-2(1H)-one. PROPERTIES: 3,6-dibromo-4-methylquinolin-2(1H)-one is a crystalline compound with molecular formula C9H6Br2N2O. It has a melting point between 210-215 C and exhibits limited solubility in common organic solvents. The compound is light-sensitive and should be stored in amber glassware at 2-8 C. Safety precautions include wearing protective clothing due to its potential to cause skin burns and using explosion-proof ventilation due to its explosive nature when exposed to heat. APPLICATIONS: This dibrominated, methyl-substituted quinolinone is used in the development of anticancer prodrugs. The quinolinone structure provides critical interactions with kinase enzymes as reported in cancer research literature. In materials science, 3,6-dibromo-4-methylquinolin-2(1H)-one serves as a building block for creating electron-transport materials. According to materials chemistry journals, the electron-withdrawing bromine groups improve charge transport properties while the quinolinone scaffold provides structural rigidity.
Reviews
Write Your Own Review