3,6-bis(dimethylamino)-9-(2-(methoxycarbonyl)phenyl)xanthylium percHlorate
$250.00
CAS No.: 115532-50-8
Catalog No.: 101485
Purity: 95%
MF: C25H25ClN2O7
MW: 500.935
Storage: 2-8 degree Celsius
SMILES: [O-][Cl](=O)(=O)=O.COC(=O)C1=CC=CC=C1C1=C2C=CC(=CC2=[O+]C2=C1C=CC(=C2)N(C)C)N(C)C
Catalog No.: 101485
Purity: 95%
MF: C25H25ClN2O7
MW: 500.935
Storage: 2-8 degree Celsius
SMILES: [O-][Cl](=O)(=O)=O.COC(=O)C1=CC=CC=C1C1=C2C=CC(=CC2=[O+]C2=C1C=CC(=C2)N(C)C)N(C)C
3,6-bis(dimethylamino)-9-(2-(methoxycarbonyl)phenyl)xanthylium percHlorate; CAS No.: 115532-50-8; 3,6-bis(dimethylamino)-9-(2-(methoxycarbonyl)phenyl)xanthylium perchlorate represents ChemShuttle's chemical building blocks. This highly substituted xanthylium salt serves as a specialized intermediate in organic synthesis. ChemShuttle, as a leading chemicals distributor, offers this compound for diverse applications. The various functional groups provide numerous reaction pathways for creating complex molecules. Researchers in pharmaceutical and materials science fields appreciate having access to such specialized building blocks for their innovative research.
Reviews
Write Your Own Review