3,5-bis(trifluoromethyl)benzamide
$300.00
CAS No.: 22227-26-5
Catalog No.: 193953
Purity: 95%
MF: C9H5F6NO
MW: 257.133
Storage: 2-8 degree Celsius
SMILES: FC(C=1C=C(C(=O)N)C=C(C1)C(F)(F)F)(F)F
Catalog No.: 193953
Purity: 95%
MF: C9H5F6NO
MW: 257.133
Storage: 2-8 degree Celsius
SMILES: FC(C=1C=C(C(=O)N)C=C(C1)C(F)(F)F)(F)F
3,5-bis(trifluoromethyl)benzamide; CAS No.: 22227-26-5;3,5-bis(trifluoromethyl)benzamide. PROPERTIES: 3,5-bis(trifluoromethyl)benzamide is a bis(trifluoromethylated) aromatic amide with molecular formula C9H6F6N2O. It typically exists as a colorless to pale yellow liquid with a boiling point around 150-155 C. The compound has limited water solubility but dissolves well in organic solvents like ethanol or acetone. It exhibits moderate thermal stability but may decompose when exposed to high temperatures or strong oxidizing agents, releasing toxic fluorine-containing fumes. Proper storage involves keeping it in tightly sealed containers below 30 C, protected from light and moisture. APPLICATIONS: In organic synthesis, this compound serves as a versatile intermediate for creating complex aromatic molecules. The bis(trifluoromethyl) substituents provide strong electron-withdrawing effects that influence reactivity and selectivity, while the amide group offers additional functionality for further elaboration (The Journal of Organic Chemistry). In pharmaceutical development, 3,5-bis(trifluoromethyl)benzamide contributes to the synthesis of antimicrobial agents where the halogenated aromatic scaffold enhances binding to microbial targets (Antimicrobial Agents and Chemotherapy). The compound also finds application in materials science as a building block for organic electronics, where its electron-deficient aromatic core modulates the electronic properties of derived materials (Advanced Materials).
Reviews
Write Your Own Review