(2S,4S)-1-[(tert-butoxy)carbonyl]-4-(trifluoromethyl)pyrrolidine-2-carboxylic acid
$325.00
CAS No.: 470482-41-8
Catalog No.: 170271
Purity: 95%
MF: C11H16F3NO4
MW: 283.246
Storage: 2-8 degree Celsius
SMILES: CC(C)(C)OC(=O)N1C[C@H](C[C@H]1C(O)=O)C(F)(F)F
Catalog No.: 170271
Purity: 95%
MF: C11H16F3NO4
MW: 283.246
Storage: 2-8 degree Celsius
SMILES: CC(C)(C)OC(=O)N1C[C@H](C[C@H]1C(O)=O)C(F)(F)F
(2S,4S)-1-[(tert-butoxy)carbonyl]-4-(trifluoromethyl)pyrrolidine-2-carboxylic acid; CAS No.: 470482-41-8; (2S,4S)-1-[(tert-butoxy)carbonyl]-4-(trifluoromethyl)pyrrolidine-2-carboxylic acid highlights ChemShuttle's building blocks for drug discovery. As a custom synthesis company, we provide chiral pyrrolidine derivatives with trifluoromethyl and Boc protection for research. This compound combines trifluoromethyl substitution with a tert-butoxycarbonyl-protected amine on a chiral pyrrolidine ring, providing unique steric properties. ChemShuttle's chemical synthesis expertise ensures precise stereochemistry and high purity. The protected amine allows for controlled deprotection and further conjugation, making this compound valuable in peptide synthesis and medicinal chemistry.
Reviews
Write Your Own Review