(2R)-2-(2,5-difluorophenyl)pyrrolidine hydrochloride
$250.00
CAS No.: 1218935-60-4
Catalog No.: 189003
Purity: 95%
MF: C10H12ClF2N
MW: 219.662
Storage: 2-8 degree Celsius
SMILES: Cl.FC1=C(C=C(C=C1)F)[C@@H]1NCCC1
Catalog No.: 189003
Purity: 95%
MF: C10H12ClF2N
MW: 219.662
Storage: 2-8 degree Celsius
SMILES: Cl.FC1=C(C=C(C=C1)F)[C@@H]1NCCC1
(2R)-2-(2,5-difluorophenyl)pyrrolidine hydrochloride; CAS No.: 1218935-60-4; (2R)-2-(2,5-difluorophenyl)pyrrolidine hydrochloride exemplifies the fluorinated heterocycles category within Chem Shuttle's product offerings. As a custom chemical synthesis company, Chem Shuttle provides access to chiral pyrrolidine derivatives that incorporate fluorine substituents, crucial for the development of various pharmaceuticals and agrochemicals with enhanced biological activities. This compound, with its difluorophenyl substituent and chiral pyrrolidine ring, serves as a valuable building block for the synthesis of fluorinated pharmaceuticals. Chem Shuttle's online chemical store offers researchers convenient access to such compounds, supporting their work in medicinal chemistry and organic synthesis. The company's expertise in process chemistry ensures that (2R)-2-(2,5-difluorophenyl)pyrrolidine hydrochloride is produced efficiently and to high purity standards, making it a reliable component in various synthetic pathways.
Reviews
Write Your Own Review