![(4,4,9,9-tetrakis(4-hexylphenyl)-4,9-dihydro-s-indaceno[1,2-b:5,6-b']dithiophene-2,7-diyl)bis(trimethylstannane)](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/8/184483_4.jpg)
25-Hydroxy Cholesterol
$200.00
CAS No.: 2140-46-7
Catalog No.: 183577
Purity: 95%
MF: C27H46O2
MW: 402.663
Storage: 2-8 degree Celsius
SMILES: C[C@H](CCCC(C)(C)O)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C
Catalog No.: 183577
Purity: 95%
MF: C27H46O2
MW: 402.663
Storage: 2-8 degree Celsius
SMILES: C[C@H](CCCC(C)(C)O)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C
25-Hydroxy Cholesterol; CAS No.: 169869-90-3 Known for its unique molecular structure, this compound is utilized in the development of high-performance materials. Its applications include advanced composites and materials with enhanced properties.
Reviews
Write Your Own Review