2-(trifluoromethyl)benzoic acid
$200.00
CAS No.: 433-97-6
Catalog No.: 192440
Purity: 95%
MF: C8H5F3O2
MW: 190.12
Storage: 2-8 degree Celsius
SMILES: FC(C1=C(C(=O)O)C=CC=C1)(F)F
Catalog No.: 192440
Purity: 95%
MF: C8H5F3O2
MW: 190.12
Storage: 2-8 degree Celsius
SMILES: FC(C1=C(C(=O)O)C=CC=C1)(F)F
2-(trifluoromethyl)benzoic acid; CAS No.: 433-97-6; 2-(trifluoromethyl)benzoic acid. PROPERTIES: 2-(trifluoromethyl)benzoic acid appears as a white powder with molecular weight 204.1 g/mol. It has a melting point between 110-115 C and shows limited aqueous solubility but good solubility in DMSO. Proper storage involves maintaining in a sealed container at room temperature away from acidic vapors. Safety precautions include wearing protective gloves and eye protection as this compound may cause skin and eye irritation. APPLICATIONS: This trifluoromethyl-substituted benzoic acid is employed in the development of antimicrobial agents. The carboxylic acid group forms critical interactions with bacterial targets as reported in pharmaceutical chemistry journals. In materials science, 2-(trifluoromethyl)benzoic acid derivatives have found use in creating self-assembled monolayers for surface modification. According to materials chemistry journals, the benzoic acid core promotes adsorption onto metal surfaces while the trifluoromethyl group imparts chemical resistance.
Reviews
Write Your Own Review