2-nitro-4-(trifluoromethyl)pyridin-3-ol
$800.00
CAS No.: 1803846-28-7
Catalog No.: 151003
Purity: 95%
MF: C6H3F3N2O3
MW: 208.095
Storage: 2-8 degree Celsius
SMILES: OC1=C(C=CN=C1[N+]([O-])=O)C(F)(F)F
Catalog No.: 151003
Purity: 95%
MF: C6H3F3N2O3
MW: 208.095
Storage: 2-8 degree Celsius
SMILES: OC1=C(C=CN=C1[N+]([O-])=O)C(F)(F)F
2-nitro-4-(trifluoromethyl)pyridin-3-ol; CAS No.: 1803846-28-7 - A versatile building block used in the synthesis of complex organic molecules, particularly in drug discovery. Its availability through ChemShuttle's platform facilitates innovative research and development.
Reviews
Write Your Own Review