2-methoxy-5-nitrobenzoic acid
$250.00
CAS No.: 40751-89-1
Catalog No.: 190608
Purity: 95%
MF: C8H7NO5
MW: 197.146
Storage: 2-8 degree Celsius
SMILES: COC1=C(C(=O)O)C=C(C=C1)[N+](=O)[O-]
Catalog No.: 190608
Purity: 95%
MF: C8H7NO5
MW: 197.146
Storage: 2-8 degree Celsius
SMILES: COC1=C(C(=O)O)C=C(C=C1)[N+](=O)[O-]
2-methoxy-5-nitrobenzoic acid; CAS No.: 40751-89-1; 2-methoxy-5-nitrobenzoic acid. As a chemical synthesis company, ChemShuttle specializes in offering diverse Screening compounds, including 2-methoxy-5-nitrobenzoic acid (CAS No.: 40751-89-1). This compound is a key intermediate in the synthesis of various pharmaceuticals and specialty chemicals. ChemShuttle s custom synthesis services allow for the production of such specialized compounds, meeting the specific needs of clients in the chemical and pharmaceutical industries. The company s expertise in chemical synthesis ensures high-quality and efficient production of these essential building blocks for various applications.
Reviews
Write Your Own Review