2-methoxy-5-methyl-4-nitroaniline
$200.00
CAS No.: 134-19-0
Catalog No.: 190417
Purity: 95%
MF: C8H10N2O3
MW: 182.179
Storage: 2-8 degree Celsius
SMILES: COC1=C(N)C=C(C(=C1)[N+](=O)[O-])C
Catalog No.: 190417
Purity: 95%
MF: C8H10N2O3
MW: 182.179
Storage: 2-8 degree Celsius
SMILES: COC1=C(N)C=C(C(=C1)[N+](=O)[O-])C
2-methoxy-5-methyl-4-nitroaniline; CAS No.: 134-19-0; 2-methoxy-5-methyl-4-nitroaniline. As a chemical synthesis company, ChemShuttle specializes in offering diverse Screening compounds, including 2-methoxy-5-methyl-4-nitroaniline (CAS No.: 134-19-0). This compound is a key intermediate in the synthesis of various pharmaceuticals and specialty chemicals. ChemShuttle s custom synthesis services allow for the production of such specialized compounds, meeting the specific needs of clients in the chemical and pharmaceutical industries. The company s expertise in chemical synthesis ensures high-quality and efficient production of these essential building blocks for various applications.
Reviews
Write Your Own Review