2-isopropyl-4-(trifluoromethyl)benzoic acid
$300.00
CAS No.: 1236303-14-2
Catalog No.: GS2882
Purity: 95%
MF: C11H11F3O2
MW: 232.201
Storage: 2-8 degree Celsius
SMILES: C(C)(C)C1=C(C(=O)O)C=CC(=C1)C(F)(F)F
Catalog No.: GS2882
Purity: 95%
MF: C11H11F3O2
MW: 232.201
Storage: 2-8 degree Celsius
SMILES: C(C)(C)C1=C(C(=O)O)C=CC(=C1)C(F)(F)F
2-isopropyl-4-(trifluoromethyl)benzoic acid,CAS No.: 1236303-14-2 - This building block is widely used in the synthesis of heterocyclic compounds, which are crucial in drug development. Its downstream applications include the production of antiviral and antibacterial agents. The compound's robust chemical structure and reactivity profile make it a reliable component in the synthesis of complex molecules.
Reviews
Write Your Own Review