2-hydroxy-3-nitrobenzaldehyde
$300.00
CAS No.: 5274-70-4
Catalog No.: 189290
Purity: 95%
MF: C7H5NO4
MW: 167.12
Storage: 2-8 degree Celsius
SMILES: OC1=C(C=O)C=CC=C1[N+](=O)[O-]
Catalog No.: 189290
Purity: 95%
MF: C7H5NO4
MW: 167.12
Storage: 2-8 degree Celsius
SMILES: OC1=C(C=O)C=CC=C1[N+](=O)[O-]
2-hydroxy-3-nitrobenzaldehyde; CAS No.: 5274-70-4; 2-hydroxy-3-nitrobenzaldehyde is one of the many hydroxynitrobenzaldehydes available through Chem Shuttle's extensive product offerings. As a custom chemical synthesis company, Chem Shuttle specializes in producing benzaldehyde derivatives with hydroxy and nitro substituents that are crucial for the development of various pharmaceuticals and agrochemicals with specific biological activities. This compound, with its hydroxy and nitro groups, serves as a valuable building block for the synthesis of bioactive molecules targeting specific enzymes and receptors. Chem Shuttle's role as a worldwide chemical supplier ensures that researchers and manufacturers can access high-purity forms of 2-hydroxy-3-nitrobenzaldehyde. The company's expertise in process chemistry allows for the efficient production of this hydroxynitrobenzaldehyde, supporting innovation in medicinal chemistry and organic synthesis by providing reliable access to essential chemical components.
Reviews
Write Your Own Review