2-chloro-6-nitroanisole
$300.00
CAS No.: 80866-77-9
Catalog No.: 189274
Purity: 95%
MF: C7H6ClNO3
MW: 187.582
Storage: 2-8 degree Celsius
SMILES: ClC1=C(C(=CC=C1)[N+](=O)[O-])OC
Catalog No.: 189274
Purity: 95%
MF: C7H6ClNO3
MW: 187.582
Storage: 2-8 degree Celsius
SMILES: ClC1=C(C(=CC=C1)[N+](=O)[O-])OC
2-chloro-6-nitroanisole; CAS No.: 80866-77-9; 2-chloro-6-nitroanisole belongs to Chem Shuttle's collection of chloronitroanisoles that serve as key intermediates in organic synthesis. As a leading chemicals distributor, Chem Shuttle offers access to anisole derivatives with chloro and nitro substituents that are essential for the development of various pharmaceuticals and agrochemicals. This compound, with its chloro, nitro, and methoxy groups, is particularly valuable as a building block for the synthesis of bioactive molecules with specific receptor affinities. Chem Shuttle's custom compound synthesis services allow for the production of such specialized chemicals to exact specifications, supporting the discovery of novel therapeutic agents. The company's focus on chemical blocks ensures that researchers can obtain high-purity 2-chloro-6-nitroanisole, facilitating advancements in medicinal chemistry and organic synthesis.
Reviews
Write Your Own Review