2-chloro-1-(3,4-dichlorophenyl)ethanone
$450.00
CAS No.: 42981-08-8
Catalog No.: 189367
Purity: 95%
MF: C8H5Cl3O
MW: 223.486
Storage: 2-8 degree Celsius
SMILES: ClCC(=O)C1=CC(=C(C=C1)Cl)Cl
Catalog No.: 189367
Purity: 95%
MF: C8H5Cl3O
MW: 223.486
Storage: 2-8 degree Celsius
SMILES: ClCC(=O)C1=CC(=C(C=C1)Cl)Cl
2-chloro-1-(3,4-dichlorophenyl)ethanone; CAS No.: 42981-08-8; 2-chloro-1-(3,4-dichlorophenyl)ethanone is one of the many chlorinated aromatic ketones available through Chem Shuttle's extensive product offerings. As a custom chemical synthesis company, Chem Shuttle specializes in producing ethanone derivatives with chloro and phenyl substituents that are crucial for the development of various pharmaceuticals and agrochemicals. This compound, with its chloro and dichlorophenyl groups, serves as a valuable building block for the synthesis of bioactive molecules with specific spatial configurations. Chem Shuttle's online chemical mall provides researchers with convenient access to such specialized chemicals, supporting their work in medicinal chemistry and organic synthesis. The company's expertise in process chemistry ensures that 2-chloro-1-(3,4-dichlorophenyl)ethanone is produced efficiently and to high purity standards, making it a reliable component in various synthetic pathways.
Reviews
Write Your Own Review