2-bromo-5-methylbenzene-1-sulfonyl chloride
$300.00
CAS No.: 141113-98-6
Catalog No.: 190533
Purity: 95%
MF: C7H6BrClO2S
MW: 269.547
Storage: 2-8 degree Celsius
SMILES: BrC1=C(C=C(C=C1)C)S(=O)(=O)Cl
Catalog No.: 190533
Purity: 95%
MF: C7H6BrClO2S
MW: 269.547
Storage: 2-8 degree Celsius
SMILES: BrC1=C(C=C(C=C1)C)S(=O)(=O)Cl
2-bromo-5-methylbenzene-1-sulfonyl chloride; CAS No.: 141113-98-6; 2-bromo-5-methylbenzene-1-sulfonyl chloride. ChemShuttle, a prominent custom synthesis company, offers 2-bromo-5-methylbenzene-1-sulfonyl chloride (CAS No.: 141113-98-6) as part of its diverse Screening compounds collection. This compound is a valuable pharma building block used in the development of novel therapeutics. The company s expertise in process chemistry enables the efficient production of such specialized compounds, meeting the demands of pharmaceutical research. 2-bromo-5-methylbenzene-1-sulfonyl chloride serves as a crucial building block for drug discovery, highlighting ChemShuttle s commitment to providing high-quality chemical solutions for the pharmaceutical industry.
Reviews
Write Your Own Review