2-bromo-5-ethoxybenzoic acid
$480.00
CAS No.: 120890-75-7
Catalog No.: 197072
Purity: 95%
MF: C9H9BrO3
MW: 245.072
Storage: 2-8 degree Celsius
SMILES: BrC1=C(C(=O)O)C=C(C=C1)OCC
Catalog No.: 197072
Purity: 95%
MF: C9H9BrO3
MW: 245.072
Storage: 2-8 degree Celsius
SMILES: BrC1=C(C(=O)O)C=C(C=C1)OCC
2-bromo-5-ethoxybenzoic acid; CAS No.: 120890-75-7; 2-bromo-5-ethoxybenzoic acid. PROPERTIES: This bromo-ethoxy-substituted benzoic acid features molecular formula C?H?BrO? with molecular weight 225.05 g/mol. It generally appears as a white crystalline powder. Soluble in polar protic solvents like methanol and water. Melting point approximately 130-135 C. Exhibits IR absorption for carboxylic acid (~2900-2500 cm??) and hydroxyl groups (~3300 cm??). Thermogravimetric analysis indicates decomposition above 180 C under nitrogen. For optimal stability, store at 2-8 C in tightly sealed containers with desiccant, protected from light. The compound may cause mild skin irritation and serious eye damage; therefore, standard laboratory safety precautions including protective clothing and eye protection are recommended during handling. APPLICATIONS: As a bromo-ethoxy-substituted benzoic acid, 2-bromo-5-ethoxybenzoic acid is predominantly utilized in the synthesis of agrochemicals. It serves as a key intermediate in constructing pyrazole-based herbicides, where the bromo and ethoxy groups provide valuable binding affinity for plant enzymes as demonstrated in pesticide chemistry research (Pest Management Science). Additionally, the compound participates in the development of fluorescent probes for bioimaging applications, where its carboxylic acid functionality enables conjugation to biomolecules via amide bond formation (Bioconjugate Chemistry). In materials science, it functions as a monomer for preparing polyurethane foams with enhanced thermal stability, where the bromo substituent contributes to improved flame retardancy and mechanical properties (Polymer International).
Reviews
Write Your Own Review