2-amino-3,5-dichlorobenzoic acid
$200.00
CAS No.: 2789-92-6
Catalog No.: 189346
Purity: 95%
MF: C7H5Cl2NO2
MW: 206.028
Storage: 2-8 degree Celsius
SMILES: NC1=C(C(=O)O)C=C(C=C1Cl)Cl
Catalog No.: 189346
Purity: 95%
MF: C7H5Cl2NO2
MW: 206.028
Storage: 2-8 degree Celsius
SMILES: NC1=C(C(=O)O)C=C(C=C1Cl)Cl
For R&D use only. Not for human or animal use.
2-amino-3,5-dichlorobenzoic acid; CAS No.: 2789-92-6; 2-amino-3,5-dichlorobenzoic acid exemplifies the aminochlorobenzoic acids category within Chem Shuttle's product offerings. As a chemical online store, Chem Shuttle provides access to benzoic acid derivatives with amino and chloro substituents that are crucial for the development of various pharmaceuticals and agrochemicals with specific biological activities. This compound, with its amino and dichloro groups, serves as a valuable building block for the synthesis of bioactive molecules targeting specific enzymes and receptors. Chem Shuttle's custom synthesis services allow for the production of such specialized aminochlorobenzoic acids to exact specifications, supporting the discovery of novel therapeutic agents. The company's expertise in cycle compounds ensures that researchers can obtain high-purity 2-amino-3,5-dichlorobenzoic acid, facilitating advancements in medicinal chemistry and organic synthesis.
Reviews
Write Your Own Review