2-(7-aza-1H-benzotriazole-1-yl)-1,1,3,3-tetramethyluronium hexafluorophosphate
$250.00
CAS No.: 148893-10-1
Catalog No.: 113438
Purity: 95%
MF: C10H15F6N6OP
MW: 380.233
Storage: 2-8 degree Celsius
SMILES: F[P-](F)(F)(F)(F)F.CN(C)C(=[O+]N1N=NC2=CC=CN=C12)N(C)C
Catalog No.: 113438
Purity: 95%
MF: C10H15F6N6OP
MW: 380.233
Storage: 2-8 degree Celsius
SMILES: F[P-](F)(F)(F)(F)F.CN(C)C(=[O+]N1N=NC2=CC=CN=C12)N(C)C
2-(7-aza-1H-benzotriazole-1-yl)-1,1,3,3-tetramethyluronium hexafluorophosphate; CAS No.: 148893-10-1 Exhibiting distinct physicochemical properties, this compound is used in the agrochemical industry. It serves as an intermediate in the synthesis of crop protection agents, enhancing their efficacy and stability.
Reviews
Write Your Own Review