2',6-bis(hexyloxy)-5'-((4-(2,2,2-trifluoroacetamido)butyl)carbamoyl)-[1,1'-biphenyl]-3-carboxylic acid
$360.00
CAS No.: 2901039-58-3
Catalog No.: 198310
Purity: 95%
MF: C32H43F3N2O6
MW: 608.698
Storage: 2-8 degree Celsius
SMILES: C(CCCCC)OC1=C(C=C(C=C1)C(NCCCCNC(C(F)(F)F)=O)=O)C1=CC(=CC=C1OCCCCCC)C(=O)O
Catalog No.: 198310
Purity: 95%
MF: C32H43F3N2O6
MW: 608.698
Storage: 2-8 degree Celsius
SMILES: C(CCCCC)OC1=C(C=C(C=C1)C(NCCCCNC(C(F)(F)F)=O)=O)C1=CC(=CC=C1OCCCCCC)C(=O)O
CAS No.:2901039-58-3;2',6-bis(hexyloxy)-5'-((4-(2,2,2-trifluoroacetamido)butyl)carbamoyl)-[1,1'-biphenyl]-3-carboxylic acid;ChemShuttle distinguishes itself as a custom chemical synthesis company by providing unique building blocks such as the 2',6-bis(hexyloxy)-5'-((4-(2,2,2-trifluoroacetamido)butyl)carbamoyl)-[1,1'-biphenyl]-3-carboxylic acid (CAS No.:2901039-58-3). This compound combines the reactivity of a trifluoroacetamido group with the stability imparted by the hexyloxy and biphenyl substituents, making it an excellent candidate for custom compound synthesis. As a chemical online mall, we recognize the growing demand for such specialized heterocycles in the pharmaceutical industry. The hexyloxy and carbamoyl functionalities provide valuable points for chemical modification, while the biphenyl core adds structural diversity. Researchers can benefit from our expertise in small molecules synthesis to produce this compound in the quantities needed for their experiments, supported by our full-time equivalent model that dedicates resources specifically to their projects.
Reviews
Write Your Own Review