![2,6,10-tris(4-bromophenyl)benzo[lmn]phenanthridino[2,1,10,9-defgh][2,8]phenanthroline](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/8/184884_1.jpg)
![2,6,10-tri-p-tolylbenzo[lmn]phenanthridino[2,1,10,9-defgh][2,8]phenanthroline](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/8/184882_1.jpg)
2,6,10-tris(trifluoromethyl)benzo[lmn]phenanthridino[2,1,10,9-defgh][2,8]phenanthroline
$800.00
CAS No.: 1818201-41-0
Catalog No.: 184883
Purity: 95%
MF: C24H6F9N3
MW: 507.315
Storage: 2-8 degree Celsius
SMILES: FC(F)(F)C1=NC2=CC=C3C(=NC4=CC=C5C(=NC6=CC=C1C1=C6C5=C4C3=C21)C(F)(F)F)C(F)(F)F
Catalog No.: 184883
Purity: 95%
MF: C24H6F9N3
MW: 507.315
Storage: 2-8 degree Celsius
SMILES: FC(F)(F)C1=NC2=CC=C3C(=NC4=CC=C5C(=NC6=CC=C1C1=C6C5=C4C3=C21)C(F)(F)F)C(F)(F)F
2,6,10-tris(trifluoromethyl)benzo[lmn]phenanthridino[2,1,10,9-defgh][2,8]phenanthroline; CAS No.: 1818201-41-0; 2,6,10-tris(trifluoromethyl)benzo[lmn]phenanthridino[2,1,10,9-defgh][2,8]phenanthroline is considered a key intermediate in ChemShuttle's product range, offering a unique combination of trifluoromethyl groups and complex polycyclic architecture that can enhance target engagement in various therapeutic areas. As a worldwide chemical supplier with expertise in heterocycles, ChemShuttle offers this compound with detailed information on its synthetic applications and recommended routes for further elaboration. The trifluoromethyl groups enhance the compound's metabolic stability, making it suitable for developing agents with improved pharmacokinetic properties. ChemShuttle's custom chemical synthesis services can incorporate additional substituents or modify the existing groups to better match specific research requirements. Researchers benefit from the company's efficient ordering system, which streamlines the procurement process for this and related compounds used in medicinal chemistry projects targeting challenging biological targets.
Reviews
Write Your Own Review