2-(4-fluoro-3-(trifluoromethyl)phenyl)-2-hydroxyacetic acid
$360.00
CAS No.: 1214323-21-3
Catalog No.: 198369
Purity: 95%
MF: C9H6F4O3
MW: 238.136
Storage: 2-8 degree Celsius
SMILES: FC1=C(C=C(C=C1)C(C(=O)O)O)C(F)(F)F
Catalog No.: 198369
Purity: 95%
MF: C9H6F4O3
MW: 238.136
Storage: 2-8 degree Celsius
SMILES: FC1=C(C=C(C=C1)C(C(=O)O)O)C(F)(F)F
CAS No.:1214323-21-3;2-(4-fluoro-3-(trifluoromethyl)phenyl)-2-hydroxyacetic acid;ChemShuttle distinguishes itself as a custom chemical synthesis company by providing unique building blocks such as the 2-(4-fluoro-3-(trifluoromethyl)phenyl)-2-hydroxyacetic acid (CAS No.:1214323-21-3). This compound combines the reactivity of a hydroxyacetic acid core with the stability imparted by the fluoro and trifluoromethyl substituents, making it an excellent candidate for custom compound synthesis. As a chemical online mall, we recognize the growing demand for such specialized heterocycles in the pharmaceutical industry. The hydroxyl and carboxylic acid functionalities provide valuable points for chemical modification, while the fluoro and trifluoromethyl substituents offer unique electronic properties. Researchers can benefit from our expertise in small molecules synthesis to produce this compound in the quantities needed for their experiments, supported by our full-time equivalent model that dedicates resources specifically to their projects.
Reviews
Write Your Own Review