![4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)-2-fluoro-3-methylaniline](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/9/199131_1.jpg)
(2,4-difluorophenyl)(4-fluoro-2-methoxyphenyl)methanone
$1,200.00
CAS No.: 2747248-53-7
Catalog No.: 199132
Purity: 95%
MF: C14H9F3O2
MW: 266.218
Storage: 2-8 degree Celsius
SMILES: FC1=C(C=CC(=C1)F)C(=O)C1=C(C=C(C=C1)F)OC
Catalog No.: 199132
Purity: 95%
MF: C14H9F3O2
MW: 266.218
Storage: 2-8 degree Celsius
SMILES: FC1=C(C=CC(=C1)F)C(=O)C1=C(C=C(C=C1)F)OC
CAS No.: 2747248-53-7; (2,4-difluorophenyl)(4-fluoro-2-methoxyphenyl)methanone is part of ChemShuttle's pharma building blocks inventory. This compound offers unique electronic properties that make it valuable for constructing novel pharmaceutical agents. As a chemical blocks supplier, ChemShuttle provides this CAS 2747248-53-7 compound through their online platform, connecting researchers with essential chemical resources. The fluorinated aryl groups enhance the compound's reactivity and bioavailability profiles, making it particularly useful in modern drug discovery. ChemShuttle's process chemistry expertise ensures consistent production of high-quality compounds like this one. Researchers can incorporate the CAS 2747248-53-7 building block into diverse synthetic pathways, benefiting from ChemShuttle's efficient distribution network and commitment to quality.
Reviews
Write Your Own Review