2-(4-chloro-3-(trifluoromethyl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
$300.00
CAS No.: 445303-09-3
Catalog No.: 185536
Purity: 95%
MF: C13H15BClF3O2
MW: 306.52
Storage: 2-8 degree Celsius
SMILES: ClC1=C(C=C(C=C1)B1OC(C(O1)(C)C)(C)C)C(F)(F)F
Catalog No.: 185536
Purity: 95%
MF: C13H15BClF3O2
MW: 306.52
Storage: 2-8 degree Celsius
SMILES: ClC1=C(C=C(C=C1)B1OC(C(O1)(C)C)(C)C)C(F)(F)F
2-(4-chloro-3-(trifluoromethyl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane; CAS No.: 445303-09-3; Known for their expertise in cycle compounds, ChemShuttle offers custom chemical synthesis services. These compounds are crucial for various industrial applications, including the production of polymers and specialty chemicals.
Reviews
Write Your Own Review