2,3-dichloro-4-nitroaniline
$200.00
CAS No.: 69951-03-7
Catalog No.: 190714
Purity: 95%
MF: C6H4Cl2N2O2
MW: 207.016
Storage: 2-8 degree Celsius
SMILES: ClC1=C(N)C=CC(=C1Cl)[N+](=O)[O-]
Catalog No.: 190714
Purity: 95%
MF: C6H4Cl2N2O2
MW: 207.016
Storage: 2-8 degree Celsius
SMILES: ClC1=C(N)C=CC(=C1Cl)[N+](=O)[O-]
2,3-dichloro-4-nitroaniline; CAS No.: 69951-03-7; 2,3-dichloro-4-nitroaniline is a valuable heterocycle compound offered by ChemShuttle, a leading chemical synthesis company specializing in providing diverse organic chemicals for research and development. This aromatic amine derivative, featuring dichloro and nitro substituents, serves as a key intermediate in the synthesis of various pharmaceuticals and agrochemicals. ChemShuttle's extensive inventory of building blocks for drug discovery includes numerous halogenated anilines like 2,3-dichloro-4-nitroaniline (CAS No.: 69951-03-7), which are essential for medicinal chemistry applications. The company's custom synthesis services enable researchers to access tailored compounds, leveraging ChemShuttle's expertise in heterocyclic chemistry. As a worldwide chemical supplier, ChemShuttle ensures reliable supply of high-purity 2,3-dichloro-4-nitroaniline and related derivatives, supporting global research initiatives in drug discovery and chemical development.
Reviews
Write Your Own Review