2-(3,5-dimethoxyphenyl)acetic acid
$250.00
CAS No.: 4670-10-4
Catalog No.: 190632
Purity: 95%
MF: C10H12O4
MW: 196.202
Storage: 2-8 degree Celsius
SMILES: COC=1C=C(C=C(C1)OC)CC(=O)O
Catalog No.: 190632
Purity: 95%
MF: C10H12O4
MW: 196.202
Storage: 2-8 degree Celsius
SMILES: COC=1C=C(C=C(C1)OC)CC(=O)O
2-(3,5-dimethoxyphenyl)acetic acid; CAS No.: 4670-10-4; 2-(3,5-Dimethoxyphenyl)acetic acid is a specialty chemical available through ChemShuttle, a reputable custom chemical synthesis company. This compound, with its dimethoxyphenyl group, serves as a building block for the development of more complex organic molecules. As part of their chem blocks offerings, ChemShuttle supplies 2-(3,5-dimethoxyphenyl)acetic acid (CAS No.: 4670-10-4) to support researchers in their drug discovery endeavors. The company's custom synthesis services allow for the tailored production of this compound, ensuring it meets the specific requirements of various research projects. ChemShuttle's role as a worldwide chemical supplier ensures the availability of high-purity chemicals like this one, contributing to advancements in organic chemistry and pharmaceutical research.
Reviews
Write Your Own Review