2,3,4-trifluoro-5-nitrobenzoic acid
$500.00
CAS No.: 197520-71-1
Catalog No.: 193846
Purity: 95%
MF: C7H2F3NO4
MW: 221.09
Storage: 2-8 degree Celsius
SMILES: FC1=C(C(=O)O)C=C(C(=C1F)F)[N+](=O)[O-]
Catalog No.: 193846
Purity: 95%
MF: C7H2F3NO4
MW: 221.09
Storage: 2-8 degree Celsius
SMILES: FC1=C(C(=O)O)C=C(C(=C1F)F)[N+](=O)[O-]
2,3,4-trifluoro-5-nitrobenzoic acid; CAS No.: 197520-71-1;2,3,4-trifluoro-5-nitrobenzoic acid. PROPERTIES: 2,3,4-trifluoro-5-nitrobenzoic acid is a fluorinated and nitrated aromatic carboxylic acid with molecular formula C7H3F3NO4. It typically exists as a white to off-white crystalline powder with a melting point of approximately 195-200 C. The compound has limited water solubility but dissolves in basic aqueous solutions. It exhibits moderate thermal stability but may decompose when exposed to high temperatures or strong reducing agents, releasing toxic nitrogen oxides and fluorine-containing fumes. Proper storage involves keeping it in tightly sealed containers below 25 C, protected from light and moisture. APPLICATIONS: In pharmaceutical research, this compound serves as a lead structure for developing antimicrobial and anticancer agents. The trifluoro substitution provides electron-withdrawing effects that enhance binding to biological targets, while the nitro group can generate bioactive nitric oxide under physiological conditions (European Journal of Medicinal Chemistry). In materials science, 2,3,4-trifluoro-5-nitrobenzoic acid contributes to the creation of functional organic materials with tailored electronic properties. Its fluorinated aromatic core and nitro group influence the electronic characteristics of derived materials, useful in optoelectronic applications such as organic field-effect transistors (Journal of Materials Chemistry C). The carboxylic acid group enables formation of coordination polymers or metal-organic frameworks with potential applications in gas storage or catalysis (Chemistry of Materials).
Reviews
Write Your Own Review