2-(2-fluoro-4-nitrophenyl)acetonitrile
$350.00
CAS No.: 853910-00-6
Catalog No.: 190743
Purity: 95%
MF: C8H5FN2O2
MW: 180.138
Storage: 2-8 degree Celsius
SMILES: FC1=C(C=CC(=C1)[N+](=O)[O-])CC#N
Catalog No.: 190743
Purity: 95%
MF: C8H5FN2O2
MW: 180.138
Storage: 2-8 degree Celsius
SMILES: FC1=C(C=CC(=C1)[N+](=O)[O-])CC#N
2-(2-fluoro-4-nitrophenyl)acetonitrile; CAS No.: 853910-00-6; 2-(2-fluoro-4-nitrophenyl)acetonitrile represents one of ChemShuttle's specialized pharma building blocks, designed to support drug discovery initiatives through its unique substitution pattern. This fluoro-nitro substituted nitrile derivative provides versatile reactivity for forming amide bonds or undergoing cross-coupling reactions. ChemShuttle's library of compounds includes numerous fluorinated aromatics like 2-(2-fluoro-4-nitrophenyl)acetonitrile (CAS No.: 853910-00-6), which are essential for developing pharmaceuticals with optimized pharmacokinetic profiles. As a custom synthesis provider, ChemShuttle can produce this compound in various quantities and purities, catering to specific research needs. Their online platform simplifies access to such specialized building blocks, enabling researchers to rapidly incorporate these valuable intermediates into their drug discovery pipelines.
Reviews
Write Your Own Review