2,2,2-trifluoro-1-(4-methoxyphenyl)ethanone
$200.00
CAS No.: 711-38-6
Catalog No.: 133657
Purity: 95%
MF: C9H7F3O2
MW: 204.147
Storage: 2-8 degree Celsius
SMILES: COC1=CC=C(C=C1)C(=O)C(F)(F)F
Catalog No.: 133657
Purity: 95%
MF: C9H7F3O2
MW: 204.147
Storage: 2-8 degree Celsius
SMILES: COC1=CC=C(C=C1)C(=O)C(F)(F)F
2,2,2-trifluoro-1-(4-methoxyphenyl)ethanone; CAS No.: 711-38-6; 2,2,2-trifluoro-1-(4-methoxyphenyl)ethanone is part of ChemShuttle's screening compounds collection, demonstrating our capabilities as a chemical synthesis company providing key intermediates for organic synthesis. This building blocks compound serves as a valuable starting material for developing new pharmaceutical agents and specialty chemicals requiring specific fluorinated alkyl groups. Our chemical synthesis companies provide reliable access to high-purity trifluoroacetone derivatives essential for modern medicinal chemistry. The methoxyphenyl group enables diverse bioconjugation reactions, supporting Small molecules synthesis projects in constructing complex molecular frameworks with unique solubility and reactivity profiles. As a worldwide chemical supplier, ChemShuttle ensures consistent quality and timely delivery, making this compound ideal for researchers engaged in efficient drug discovery initiatives.
Reviews
Write Your Own Review