2-(4-bromophenyl)cyclopropane-1-carboxylic acid

2-(4-bromophenyl)cyclopropane-1-carboxylic acid

(1R)-2-methyl-1-phenylbutan-1-amine hydrochloride

(1R)-2-methyl-1-phenylbutan-1-amine hydrochloride

(1S,2R)-2-(4-fluorophenyl)cyclopropan-1-amine hydrochloride

$300.00
CAS No.: 1990505-73-1
Catalog No.: 160314
Purity: 95%
MF: C9H11ClFN
MW: 187.645
Storage: 2-8 degree Celsius
SMILES: Cl.N[C@H]1C[C@@H]1C1=CC=C(F)C=C1
Availability:
In stock
SKU
160314
  • Size
    Price
    Stock
    Estimated Shipping Time
(1S,2R)-2-(4-fluorophenyl)cyclopropan-1-amine hydrochloride; CAS No.: 1990505-73-1; (1S,2R)-2-(4-fluorophenyl)cyclopropan-1-amine hydrochloride is part of ChemShuttle's collection of various organic chemicals, which are used extensively in chemical research and synthesis. As a various organic chemical with unique structural features, this compound highlights the company's ability to supply specialized building blocks for the development of new pharmaceuticals. The various organic chemicals offered by ChemShuttle, including (1S,2R)-2-(4-fluorophenyl)cyclopropan-1-amine hydrochloride (CAS No.: 1990505-73-1), are essential for enabling researchers to construct complex molecules with potential therapeutic applications. These various organic chemicals serve as the foundation for numerous custom synthesis projects, facilitating the exploration of new chemical spaces in the quest for potential drug candidates. By supplying a diverse array of various organic chemicals, ChemShuttle ensures that scientists have access to the necessary components to advance their research. The (1S,2R)-2-(4-fluorophenyl)cyclopropan-1-amine hydrochloride (CAS No.: 1990505-73-1) exemplifies the company's dedication to providing high-quality building blocks that contribute to innovation in chemical synthesis.

Reviews

Write Your Own Review
You're reviewing:(1S,2R)-2-(4-fluorophenyl)cyclopropan-1-amine hydrochloride
Your Rating