Efavirenz (Synonyms: DMP 266; EFV; L-743726)
$200.00
CAS No.: 154598-52-4
Catalog No.: 141032
Purity: 95%
MF: C14H9ClF3NO2
MW: 315.678
Storage: 2-8 degree Celsius
SMILES: FC(F)(F)[C@]1(OC(=O)NC2=CC=C(Cl)C=C12)C#CC1CC1
Catalog No.: 141032
Purity: 95%
MF: C14H9ClF3NO2
MW: 315.678
Storage: 2-8 degree Celsius
SMILES: FC(F)(F)[C@]1(OC(=O)NC2=CC=C(Cl)C=C12)C#CC1CC1
For R&D use only. Not for human or veterinary use.
![(S)-8-chloro-2-(trifluoromethyl)-3,4-dihydro-1H-pyrimido[1,2-a]pyrimidin-6(2H)-one](https://www.chemshuttle.com/media/catalog/product/cache/eda3e020a548044183bce7a8a96486f8/1/2/129203_3.jpg)
(S)-6-chloro-4-(cyclopropylethynyl)-4-(trifluoromethyl)-1H-benzo[d][1,3]oxazin-2(4H)-one; CAS No.: 293754-55-9 This chemical is utilized in the pharmaceutical sector due to its specific molecular structure and reactivity. It is involved in the synthesis of therapeutic agents, contributing to advancements in medical treatments.
Reviews
Write Your Own Review