1-methoxy-2,4-dimethyl-3-nitrobenzene
$300.00
CAS No.: 95644-98-7
Catalog No.: 198293
Purity: 95%
MF: C9H11NO3
MW: 181.191
Storage: 2-8 degree Celsius
SMILES: COC1=C(C(=C(C=C1)C)[N+](=O)[O-])C
Catalog No.: 198293
Purity: 95%
MF: C9H11NO3
MW: 181.191
Storage: 2-8 degree Celsius
SMILES: COC1=C(C(=C(C=C1)C)[N+](=O)[O-])C
CAS No.:95644-98-7;1-methoxy-2,4-dimethyl-3-nitrobenzene;ChemShuttle distinguishes itself as a custom chemical synthesis company by providing unique building blocks such as the 1-methoxy-2,4-dimethyl-3-nitrobenzene (CAS No.:95644-98-7). This compound combines the reactivity of a nitro group with the stability imparted by the methoxy and dimethyl substituents, making it an excellent candidate for custom compound synthesis. As a chemical online mall, we recognize the growing demand for such specialized heterocycles in the pharmaceutical industry. The methoxy, dimethyl, and nitro functionalities provide valuable points for chemical modification, while the benzene core adds structural diversity. Researchers can benefit from our expertise in small molecules synthesis to produce this compound in the quantities needed for their experiments, supported by our full-time equivalent model that dedicates resources specifically to their projects.
Reviews
Write Your Own Review