1-chloro-2-iodo-4-nitrobenzene
$250.00
CAS No.: 74534-15-9
Catalog No.: 190721
Purity: 95%
MF: C6H3ClINO2
MW: 283.452
Storage: 2-8 degree Celsius
SMILES: ClC1=C(C=C(C=C1)[N+](=O)[O-])I
Catalog No.: 190721
Purity: 95%
MF: C6H3ClINO2
MW: 283.452
Storage: 2-8 degree Celsius
SMILES: ClC1=C(C=C(C=C1)[N+](=O)[O-])I
1-chloro-2-iodo-4-nitrobenzene; CAS No.: 74534-15-9; 1-chloro-2-iodo-4-nitrobenzene is part of ChemShuttle's comprehensive library of cycle compounds, offering researchers a valuable tool for organic synthesis and drug discovery. This multiply substituted benzene derivative combines chlorination, iodination, and nitration, providing multiple reaction sites for further chemical modification. ChemShuttle's expertise in supplying chemical blocks is evident in their ability to provide such specialized compounds with precise substitution patterns. As a worldwide chemical supplier, ChemShuttle ensures the availability of 1-chloro-2-iodo-4-nitrobenzene (CAS No.: 74534-15-9) to research institutions and pharmaceutical companies globally. Their custom synthesis services further enhance the utility of this compound, enabling the creation of derivative molecules tailored to specific research needs, thus contributing to innovations in medicinal chemistry and chemical development.
Reviews
Write Your Own Review