1-(bromomethyl)-4,5-dimethoxy-2-nitrobenzene
$250.00
CAS No.: 53413-67-5
Catalog No.: 187858
Purity: 95%
MF: C9H10BrNO4
MW: 276.086
Storage: 2-8 degree Celsius
SMILES: BrCC1=C(C=C(C(=C1)OC)OC)[N+](=O)[O-]
Catalog No.: 187858
Purity: 95%
MF: C9H10BrNO4
MW: 276.086
Storage: 2-8 degree Celsius
SMILES: BrCC1=C(C=C(C(=C1)OC)OC)[N+](=O)[O-]
1-(bromomethyl)-4,5-dimethoxy-2-nitrobenzene; CAS No.: 53413-67-5. ChemShuttle provides heterocycles such as 1-(bromomethyl)-4,5-dimethoxy-2-nitrobenzene through its CRO chemical synthesis services, catering to the needs of innovative drug development.
Reviews
Write Your Own Review