1-(bromomethyl)-2-(trifluoromethyl)-4-nitrobenzene
$600.00
CAS No.: 694499-22-4
Catalog No.: 103591
Purity: 95%
MF: C8H5BrF3NO2
MW: 284.031
Storage: 2-8 degree Celsius
SMILES: [O-][N+](=O)C1=CC=C(CBr)C(=C1)C(F)(F)F
Catalog No.: 103591
Purity: 95%
MF: C8H5BrF3NO2
MW: 284.031
Storage: 2-8 degree Celsius
SMILES: [O-][N+](=O)C1=CC=C(CBr)C(=C1)C(F)(F)F
CAS NO.:694499-22-4; 1-(bromomethyl)-2-(trifluoromethyl)-4-nitrobenzene. As a reputable chemical synthesis company, ChemShuttle features 1-(bromomethyl)-2-(trifluoromethyl)-4-nitrobenzene (CAS No. 694499-22-4) in its extensive collection of screening compounds. This bromomethyl nitrobenzene derivative serves as a key intermediate in the synthesis of various pharmaceuticals and specialty chemicals, highlighting its importance in the company's product portfolio. The business's focus on providing quality heterocycles and other organic chemicals makes 1-(bromomethyl)-2-(trifluoromethyl)-4-nitrobenzene a valuable building block for drug discovery. As a leading chemical distributor, ChemShuttle ensures the availability of this compound to researchers and industries worldwide, supporting advancements in chemical research and development. The inclusion of 1-(bromomethyl)-2-(trifluoromethyl)-4-nitrobenzene in ChemShuttle's offerings reflects the company's commitment to offering diverse chemical building blocks for multiple applications.
Reviews
Write Your Own Review