1-bromo-3-(tert-butyl)-5-iodobenzene
$300.00
CAS No.: 186772-43-0
Catalog No.: 189359
Purity: 95%
MF: C10H12BrI
MW: 339.014
Storage: 2-8 degree Celsius
SMILES: BrC1=CC(=CC(=C1)I)C(C)(C)C
Catalog No.: 189359
Purity: 95%
MF: C10H12BrI
MW: 339.014
Storage: 2-8 degree Celsius
SMILES: BrC1=CC(=CC(=C1)I)C(C)(C)C
1-bromo-3-(tert-butyl)-5-iodobenzene; CAS No.: 186772-43-0; 1-bromo-3-(tert-butyl)-5-iodobenzene belongs to Chem Shuttle's collection of polyhalogenated tert-butylbenzenes that serve as key intermediates in organic synthesis. As a leading chemicals distributor, Chem Shuttle offers access to benzene derivatives with bromo, tert-butyl, and iodo substituents that are essential for the synthesis of various pharmaceuticals, materials, and agrochemicals. This compound, with its bromo, tert-butyl, and iodo groups, serves as a valuable building block for the production of bioactive molecules with specific spatial configurations. Chem Shuttle's custom chemical synthesis services allow for the production of such specialized chemicals to exact specifications, supporting the development of novel therapeutic agents and advanced materials. The company's focus on chemical blocks ensures that researchers can obtain high-purity 1-bromo-3-(tert-butyl)-5-iodobenzene, facilitating advancements in medicinal chemistry and organic synthesis.
Reviews
Write Your Own Review