![8-methyl-1,4-dioxaspiro[4.5]decane-8-carbonitrile](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/8/188575_1.jpg)
![spiro[4.5]dec-6-en-8-one](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/8/188621_1.jpg)
1'-benzyl-2H-spiro[isoquinoline-1,4'-piperidin]-3(4H)-one
$376.00
CAS No.: 15142-89-9
Catalog No.: 188585
Purity: 95%
MF: C20H22N2O
MW: 306.409
Storage: 2-8 degree Celsius
SMILES: O=C1NC2(CCN(CC3=CC=CC=C3)CC2)C4=C(C=CC=C4)C1
Catalog No.: 188585
Purity: 95%
MF: C20H22N2O
MW: 306.409
Storage: 2-8 degree Celsius
SMILES: O=C1NC2(CCN(CC3=CC=CC=C3)CC2)C4=C(C=CC=C4)C1
1'-benzyl-2H-spiro[isoquinoline-1,4'-piperidin]-3(4H)-one; CAS No.: 15142-89-9; 1'-benzyl-2H-spiro[isoquinoline-1,4'-piperidin]-3(4H)-one is part of ChemShuttle's library of compounds, showcasing our expertise in chemical synthesis. As a custom chemical synthesis company, we offer various organic chemicals that serve as building blocks for drug discovery. This spiro compound, with its intricate fused-ring system, exemplifies the complex structures we can produce to support research in medicinal chemistry. Our small molecules synthesis services allow for the creation of specialized chemicals that can interact with specific biological targets, potentially leading to the development of new pharmaceutical agents. Researchers benefit from our ability to deliver high-quality, custom-synthesized compounds that meet the exacting standards required for scientific inquiry and drug development.
Reviews
Write Your Own Review