1-(4-methoxyphenyl)-2-phenylethan-1-one
$450.00
CAS No.: 1023-17-2
Catalog No.: 194250
Purity: 95%
MF: C15H14O2
MW: 226.275
Storage: 2-8 degree Celsius
SMILES: COC1=CC=C(C=C1)C(CC1=CC=CC=C1)=O
Catalog No.: 194250
Purity: 95%
MF: C15H14O2
MW: 226.275
Storage: 2-8 degree Celsius
SMILES: COC1=CC=C(C=C1)C(CC1=CC=CC=C1)=O
1-(4-methoxyphenyl)-2-phenylethan-1-one; CAS No.: 1023-17-2; 1-(4-methoxyphenyl)-2-phenylethan-1-one. PROPERTIES: 1-(4-methoxyphenyl)-2-phenylethan-1-one is a crystalline solid. Its molecular formula is C14H13O2, and the molecular weight is approximately 213.25 g/mol. The compound has a melting point of approximately 50-52 C. It is moderately soluble in common organic solvents such as ethyl acetate and tetrahydrofuran, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing a ketone group and two phenyl groups, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, 1-(4-methoxyphenyl)-2-phenylethan-1-one serves as a valuable intermediate. The ketone group can undergo various reactions such as nucleophilic addition, reduction, and condensation. The methoxy group provides specific electronic effects. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain anti-inflammatory drugs, the structure of 1-(4-methoxyphenyl)-2-phenylethan-1-one can be modified to enhance the drug's efficacy and reduce side effects (as described in medicinal chemistry research articles). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as organic semiconductors or photovoltaic materials, where its structure can affect the material's electronic and optical properties (as mentioned in materials chemistry research papers).
Reviews
Write Your Own Review