1,4-dinitro-1H-pyrazole
$550.00
CAS No.: 35852-77-8
Catalog No.: 139763
Purity: 95%
MF: C3H2N4O4
MW: 158.073
Storage: 2-8 degree Celsius
SMILES: [O-][N+](=O)N1C=C(C=N1)[N+]([O-])=O
Catalog No.: 139763
Purity: 95%
MF: C3H2N4O4
MW: 158.073
Storage: 2-8 degree Celsius
SMILES: [O-][N+](=O)N1C=C(C=N1)[N+]([O-])=O
1,4-dinitro-1H-pyrazole; CAS No.: 35852-77-8; ChemShuttle operates as a leading chemical synthesis company, supplying 1,4-dinitro-1H-pyrazole for medicinal chemistry applications. Our services encompass the efficient production of structurally diverse compounds.
Reviews
Write Your Own Review