1,4-dibromo-2,5-dichlorobenzene
$300.00
CAS No.: 4571-24-8
Catalog No.: 189270
Purity: 95%
MF: C6H2Br2Cl2
MW: 304.796
Storage: 2-8 degree Celsius
SMILES: BrC1=C(C=C(C(=C1)Cl)Br)Cl
Catalog No.: 189270
Purity: 95%
MF: C6H2Br2Cl2
MW: 304.796
Storage: 2-8 degree Celsius
SMILES: BrC1=C(C=C(C(=C1)Cl)Br)Cl
1,4-dibromo-2,5-dichlorobenzene; CAS No.: 4571-24-8; 1,4-dibromo-2,5-dichlorobenzene is part of Chem Shuttle's offering of polyhalogenated benzenes that serve as key intermediates in organic synthesis. As a custom chemical synthesis company, Chem Shuttle specializes in producing benzene derivatives with bromo and chloro substituents that are crucial for the development of various pharmaceuticals and agrochemicals. This compound, with its dibromo and dichloro groups, is particularly valuable as a building block for the synthesis of bioactive molecules with specific spatial configurations. Chem Shuttle's online chemical store provides researchers with convenient access to such specialized chemicals, supporting their work in medicinal chemistry and organic synthesis. The company's expertise in process chemistry ensures that 1,4-dibromo-2,5-dichlorobenzene is produced efficiently and to high purity standards, making it a reliable component in various synthetic pathways.
Reviews
Write Your Own Review